CAS 1251919-71-7 is the registry number for Sodium 1,3-benzoxazol-2-ylacetate, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 25g, 1g, 250mg.
Sodium 2-(1,3-benzoxazol-2-yl)acetate (CAS 1251919-71-7) is a chemical compound with the molecular formula C9H6NNaO3 and a molecular weight of 199.14 g/mol. IUPAC name: sodium 2-(1,3-benzoxazol-2-yl)acetate. InChIKey: HAQQDWJWLYKACO-UHFFFAOYSA-M.
| Molecular formula | C9H6NNaO3 |
|---|---|
| Molecular weight | 199.14 g/mol |
| IUPAC name | sodium 2-(1,3-benzoxazol-2-yl)acetate |
| InChIKey | HAQQDWJWLYKACO-UHFFFAOYSA-M |
| SMILES | C1=CC=C2C(=C1)N=C(O2)CC(=O)[O-].[Na+] |
Computed by PubChem (NCBI)