CAS 1955506-95-2 appears in our catalog under these names: sodium 2-oxo-2,3-dihydro-1h-indole-6-carboxylate, 95%, Sodium 2-oxo-2,3-dihydro-1H-indole-6-carboxylate. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 10g, 5g, 1g, 250mg.
Sodium 2-oxo-1,3-dihydroindole-6-carboxylate (CAS 1955506-95-2) is a chemical compound with the molecular formula C9H6NNaO3 and a molecular weight of 199.14 g/mol. IUPAC name: sodium 2-oxo-1,3-dihydroindole-6-carboxylate. InChIKey: ORSACVLEJRAALP-UHFFFAOYSA-M.
| Molecular formula | C9H6NNaO3 |
|---|---|
| Molecular weight | 199.14 g/mol |
| IUPAC name | sodium 2-oxo-1,3-dihydroindole-6-carboxylate |
| InChIKey | ORSACVLEJRAALP-UHFFFAOYSA-M |
| SMILES | C1C2=C(C=C(C=C2)C(=O)[O-])NC1=O.[Na+] |
Computed by PubChem (NCBI)