CAS 1251925-10-6 appears in our catalog under these names: 2-((5-Chloro-1H-1,3-benzodiazol-2-yl)methyl)-2-ethylbutanoic acid hydrochloride, 95%, 2-((5-Chloro-1H-1,3-benzodiazol-2-yl)methyl)-2-ethylbutanoic acid hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
2-[(6-chloro-1H-benzimidazol-2-yl)methyl]-2-ethylbutanoic acid;hydrochloride (CAS 1251925-10-6) is a chemical compound with the molecular formula C14H18Cl2N2O2 and a molecular weight of 317.2 g/mol. IUPAC name: 2-[(6-chloro-1H-benzimidazol-2-yl)methyl]-2-ethylbutanoic acid;hydrochloride. InChIKey: HYOPUWSZNTWFPG-UHFFFAOYSA-N.
| Molecular formula | C14H18Cl2N2O2 |
|---|---|
| Molecular weight | 317.2 g/mol |
| IUPAC name | 2-[(6-chloro-1H-benzimidazol-2-yl)methyl]-2-ethylbutanoic acid;hydrochloride |
| InChIKey | HYOPUWSZNTWFPG-UHFFFAOYSA-N |
| SMILES | CCC(CC)(CC1=NC2=C(N1)C=C(C=C2)Cl)C(=O)O.Cl |
Computed by PubChem (NCBI)