CAS 2872629-73-5 is the registry number for 2,5-DICHLORO-N-(2-(ISOPENTYLAMINO)-2-OXOETHYL)BENZAMIDE, 95%, 95%. Offered by: Chemat. Available pack sizes: 250mg, 1g, 5g.
2,5-dichloro-N-[2-(3-methylbutylamino)-2-oxoethyl]benzamide (CAS 2872629-73-5) is a chemical compound with the molecular formula C14H18Cl2N2O2 and a molecular weight of 317.2 g/mol. IUPAC name: 2,5-dichloro-N-[2-(3-methylbutylamino)-2-oxoethyl]benzamide. InChIKey: OOIRPWZIMLHXBJ-UHFFFAOYSA-N.
| Molecular formula | C14H18Cl2N2O2 |
|---|---|
| Molecular weight | 317.2 g/mol |
| IUPAC name | 2,5-dichloro-N-[2-(3-methylbutylamino)-2-oxoethyl]benzamide |
| InChIKey | OOIRPWZIMLHXBJ-UHFFFAOYSA-N |
| SMILES | CC(C)CCNC(=O)CNC(=O)C1=C(C=CC(=C1)Cl)Cl |
Computed by PubChem (NCBI)