CAS 125218-33-9 appears in our catalog under these names: N-Boc-3-fluoro-l-tyrosine, 95%, (S)-2-((tert-Butoxycarbonyl)amino)-3-(3-fluoro-4-hydroxyphenyl)propanoic acid, 98%, 98%, N-Boc-3-Fluoro-L-tyrosine, 98%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 250mg, 100mg.
(2S)-3-(3-fluoro-4-hydroxyphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (CAS 125218-33-9) is a chemical compound with the molecular formula C14H18FNO5 and a molecular weight of 299.29 g/mol. IUPAC name: (2S)-3-(3-fluoro-4-hydroxyphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid. InChIKey: PIDYYTCMUSVKTJ-JTQLQIEISA-N.
| Molecular formula | C14H18FNO5 |
|---|---|
| Molecular weight | 299.29 g/mol |
| IUPAC name | (2S)-3-(3-fluoro-4-hydroxyphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| InChIKey | PIDYYTCMUSVKTJ-JTQLQIEISA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CC1=CC(=C(C=C1)O)F)C(=O)O |
Computed by PubChem (NCBI)