CAS 221077-78-7 appears in our catalog under these names: 2-((tert-Butoxycarbonyl)amino)-3-(3-fluoro-4-hydroxyphenyl)propanoic acid, 97%, Boc-3-fluoro-DL-tyrosine. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 100mg.
3-(3-fluoro-4-hydroxyphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (CAS 221077-78-7) is a chemical compound with the molecular formula C14H18FNO5 and a molecular weight of 299.29 g/mol. IUPAC name: 3-(3-fluoro-4-hydroxyphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid. InChIKey: PIDYYTCMUSVKTJ-UHFFFAOYSA-N.
| Molecular formula | C14H18FNO5 |
|---|---|
| Molecular weight | 299.29 g/mol |
| IUPAC name | 3-(3-fluoro-4-hydroxyphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| InChIKey | PIDYYTCMUSVKTJ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC(CC1=CC(=C(C=C1)O)F)C(=O)O |
Computed by PubChem (NCBI)