CAS 1252564-57-0 is the registry number for N,N-Diethyl-3-(3-fluoro-4-methoxyphenyl)acrylamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(E)-N,N-diethyl-3-(3-fluoro-4-methoxyphenyl)prop-2-enamide (CAS 1252564-57-0) is a chemical compound with the molecular formula C14H18FNO2 and a molecular weight of 251.30 g/mol. IUPAC name: (E)-N,N-diethyl-3-(3-fluoro-4-methoxyphenyl)prop-2-enamide. InChIKey: WDUDMHNSDMYDPH-VQHVLOKHSA-N.
| Molecular formula | C14H18FNO2 |
|---|---|
| Molecular weight | 251.30 g/mol |
| IUPAC name | (E)-N,N-diethyl-3-(3-fluoro-4-methoxyphenyl)prop-2-enamide |
| InChIKey | WDUDMHNSDMYDPH-VQHVLOKHSA-N |
| SMILES | CCN(CC)C(=O)/C=C/C1=CC(=C(C=C1)OC)F |
Computed by PubChem (NCBI)