CAS 2679927-17-2 is the registry number for Rel-benzyl (3R,4R)-3-fluoro-4-methylpiperidine-1-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Benzyl (3R,4R)-3-fluoro-4-methylpiperidine-1-carboxylate (CAS 2679927-17-2) is a chemical compound with the molecular formula C14H18FNO2 and a molecular weight of 251.30 g/mol. IUPAC name: benzyl (3R,4R)-3-fluoro-4-methylpiperidine-1-carboxylate. InChIKey: WREXSUFDKADVNS-YPMHNXCESA-N.
| Molecular formula | C14H18FNO2 |
|---|---|
| Molecular weight | 251.30 g/mol |
| IUPAC name | benzyl (3R,4R)-3-fluoro-4-methylpiperidine-1-carboxylate |
| InChIKey | WREXSUFDKADVNS-YPMHNXCESA-N |
| SMILES | C[C@@H]1CCN(C[C@@H]1F)C(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)