CAS 1252617-33-6 is the registry number for (2E)-3-(4-tert-butylphenyl)-1-(4-methylphenyl)prop-2-en-1-one, 98%, 98%. Offered by: Chemat. Available pack sizes: 1g, 5g.
(E)-3-(4-tert-butylphenyl)-1-(4-methylphenyl)prop-2-en-1-one (CAS 1252617-33-6) is a chemical compound with the molecular formula C20H22O and a molecular weight of 278.4 g/mol. IUPAC name: (E)-3-(4-tert-butylphenyl)-1-(4-methylphenyl)prop-2-en-1-one. InChIKey: FCSXXURFXCTBKH-NTEUORMPSA-N.
| Molecular formula | C20H22O |
|---|---|
| Molecular weight | 278.4 g/mol |
| IUPAC name | (E)-3-(4-tert-butylphenyl)-1-(4-methylphenyl)prop-2-en-1-one |
| InChIKey | FCSXXURFXCTBKH-NTEUORMPSA-N |
| SMILES | CC1=CC=C(C=C1)C(=O)/C=C/C2=CC=C(C=C2)C(C)(C)C |
Computed by PubChem (NCBI)