Products 2409158-77-4

CAS 2409158-77-4 is the registry number for 4'-(Oct-1-yn-1-yl)-(1,1'-biphenyl)-4-ol, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 1g, 2,5g, 5g, 10g, 25g.

Structural formula: {0} (CAS {1})

4-(4-oct-1-ynylphenyl)phenol (CAS 2409158-77-4) is a chemical compound with the molecular formula C20H22O and a molecular weight of 278.4 g/mol. IUPAC name: 4-(4-oct-1-ynylphenyl)phenol. InChIKey: YKUIPFIGXGWVCO-UHFFFAOYSA-N.

Identity
Molecular formulaC20H22O
Molecular weight278.4 g/mol
IUPAC name4-(4-oct-1-ynylphenyl)phenol
InChIKeyYKUIPFIGXGWVCO-UHFFFAOYSA-N
SMILESCCCCCCC#CC1=CC=C(C=C1)C2=CC=C(C=C2)O

Computed by PubChem (NCBI)