CAS 1252640-74-6 is the registry number for 1–tert–Butyl 2–methyl (2S,4S)–4–sulfanylpyrrolidine–1,2–dicarboxylate. Offered by: GLPBio. Available pack sizes: 100mg, 250mg.
1-O-tert-butyl 2-O-methyl (2S,4R)-4-sulfanylpyrrolidine-1,2-dicarboxylate (CAS 1252640-74-6) is a chemical compound with the molecular formula C11H19NO4S and a molecular weight of 261.34 g/mol. IUPAC name: 1-O-tert-butyl 2-O-methyl (2S,4R)-4-sulfanylpyrrolidine-1,2-dicarboxylate. InChIKey: CHOZATQWCASPQA-SFYZADRCSA-N.
| Molecular formula | C11H19NO4S |
|---|---|
| Molecular weight | 261.34 g/mol |
| IUPAC name | 1-O-tert-butyl 2-O-methyl (2S,4R)-4-sulfanylpyrrolidine-1,2-dicarboxylate |
| InChIKey | CHOZATQWCASPQA-SFYZADRCSA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@@H](C[C@H]1C(=O)OC)S |
Computed by PubChem (NCBI)