Products 343616-34-2

CAS 343616-34-2 is the registry number for 4-tert-Butyl 3-methyl thiomorpholine-3,4-dicarboxylate. Offered by: Biosynth. Available pack sizes: 1g, 100mg.

Structural formula: {0} (CAS {1})

4-O-tert-butyl 3-O-methyl thiomorpholine-3,4-dicarboxylate (CAS 343616-34-2) is a chemical compound with the molecular formula C11H19NO4S and a molecular weight of 261.34 g/mol. IUPAC name: 4-O-tert-butyl 3-O-methyl thiomorpholine-3,4-dicarboxylate. InChIKey: WATXLILDVUDIBE-UHFFFAOYSA-N.

Identity
Molecular formulaC11H19NO4S
Molecular weight261.34 g/mol
IUPAC name4-O-tert-butyl 3-O-methyl thiomorpholine-3,4-dicarboxylate
InChIKeyWATXLILDVUDIBE-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)N1CCSCC1C(=O)OC

Computed by PubChem (NCBI)