CAS 125273-86-1 appears in our catalog under these names: 2-(Cyclohexanecarbonyl)-2,3,6,7-tetrahydro-4H-pyrazino[2,1-a]isoquinolin-4-one, 95%, Praziquantel EP Impurity B, Praziquantel Impurity 2(Praziquantel EP Impurity B), 1,2-Deshydro Praziquantel, >95% (HPLC), 2-(Cyclohexylcarbonyl)-2,3,6,7-tetrahydro-4H-pyrazino(2,1-a)isoquinolin-4-one. Offered by: Chemat Brand, Hubei YoungXin, TRC, Mikromol, Biosynth. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
2-(cyclohexanecarbonyl)-6,7-dihydro-3H-pyrazino[2,1-a]isoquinolin-4-one (CAS 125273-86-1) is a chemical compound with the molecular formula C19H22N2O2 and a molecular weight of 310.4 g/mol. IUPAC name: 2-(cyclohexanecarbonyl)-6,7-dihydro-3H-pyrazino[2,1-a]isoquinolin-4-one. InChIKey: RAZNCTHEBQFYML-UHFFFAOYSA-N.
| Molecular formula | C19H22N2O2 |
|---|---|
| Molecular weight | 310.4 g/mol |
| IUPAC name | 2-(cyclohexanecarbonyl)-6,7-dihydro-3H-pyrazino[2,1-a]isoquinolin-4-one |
| InChIKey | RAZNCTHEBQFYML-UHFFFAOYSA-N |
| SMILES | C1CCC(CC1)C(=O)N2CC(=O)N3CCC4=CC=CC=C4C3=C2 |
Computed by PubChem (NCBI)