CAS 125313-92-0 appears in our catalog under these names: 3-(1-Methyl-1h-indol-3-yl)-4-(1-methyl-6-nitro-1h-indol-3-yl)-1h-pyrrole-2,5-dione, 95%, MKC-1/ 99.46% (existing batch purity), MKC–1, 3-(1-Methyl-1H-indol-3-yl)-4-(1-methyl-6-nitro-1H-indol-3-yl)-1H-pyrrole-2,5-dione, 95%, 95%, MKC-1, 99.78%. Offered by: Combi-blocks, TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 100mg, 1mg, 5mg, 10mg, 25mg, 50mg, 10mM (in 1ml dmso), 10mM/1mL.
3-(1-methylindol-3-yl)-4-(1-methyl-6-nitroindol-3-yl)pyrrole-2,5-dione (CAS 125313-92-0) is a chemical compound with the molecular formula C22H16N4O4 and a molecular weight of 400.4 g/mol. IUPAC name: 3-(1-methylindol-3-yl)-4-(1-methyl-6-nitroindol-3-yl)pyrrole-2,5-dione. InChIKey: OVSKGTONMLKNPZ-UHFFFAOYSA-N.
| Molecular formula | C22H16N4O4 |
|---|---|
| Molecular weight | 400.4 g/mol |
| IUPAC name | 3-(1-methylindol-3-yl)-4-(1-methyl-6-nitroindol-3-yl)pyrrole-2,5-dione |
| InChIKey | OVSKGTONMLKNPZ-UHFFFAOYSA-N |
| SMILES | CN1C=C(C2=CC=CC=C21)C3=C(C(=O)NC3=O)C4=CN(C5=C4C=CC(=C5)[N+](=O)[O-])C |
Computed by PubChem (NCBI)