Products 2514648-06-5

CAS 2514648-06-5 is the registry number for Venetoclax Impurity 6. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

Methyl 2,4-bis(1H-pyrrolo[2,3-b]pyridin-5-yloxy)benzoate (CAS 2514648-06-5) is a chemical compound with the molecular formula C22H16N4O4 and a molecular weight of 400.4 g/mol. IUPAC name: methyl 2,4-bis(1H-pyrrolo[2,3-b]pyridin-5-yloxy)benzoate. InChIKey: XDYZVVJKWMNCGV-UHFFFAOYSA-N.

Identity
Molecular formulaC22H16N4O4
Molecular weight400.4 g/mol
IUPAC namemethyl 2,4-bis(1H-pyrrolo[2,3-b]pyridin-5-yloxy)benzoate
InChIKeyXDYZVVJKWMNCGV-UHFFFAOYSA-N
SMILESCOC(=O)C1=C(C=C(C=C1)OC2=CN=C3C(=C2)C=CN3)OC4=CN=C5C(=C4)C=CN5

Computed by PubChem (NCBI)