CAS 2514648-06-5 is the registry number for Venetoclax Impurity 6. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 2,4-bis(1H-pyrrolo[2,3-b]pyridin-5-yloxy)benzoate (CAS 2514648-06-5) is a chemical compound with the molecular formula C22H16N4O4 and a molecular weight of 400.4 g/mol. IUPAC name: methyl 2,4-bis(1H-pyrrolo[2,3-b]pyridin-5-yloxy)benzoate. InChIKey: XDYZVVJKWMNCGV-UHFFFAOYSA-N.
| Molecular formula | C22H16N4O4 |
|---|---|
| Molecular weight | 400.4 g/mol |
| IUPAC name | methyl 2,4-bis(1H-pyrrolo[2,3-b]pyridin-5-yloxy)benzoate |
| InChIKey | XDYZVVJKWMNCGV-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=C(C=C1)OC2=CN=C3C(=C2)C=CN3)OC4=CN=C5C(=C4)C=CN5 |
Computed by PubChem (NCBI)