CAS 1253375-83-5 is the registry number for Ethyl (S)-2-Cyclopentyl-2-hydroxy-2-phenylacetate. Offered by: TRC. Available pack sizes: 250mg.
Ethyl (2S)-2-cyclopentyl-2-hydroxy-2-phenylacetate (CAS 1253375-83-5) is a chemical compound with the molecular formula C15H20O3 and a molecular weight of 248.32 g/mol. IUPAC name: ethyl (2S)-2-cyclopentyl-2-hydroxy-2-phenylacetate. InChIKey: YXQLGYVHODRFHA-OAHLLOKOSA-N.
| Molecular formula | C15H20O3 |
|---|---|
| Molecular weight | 248.32 g/mol |
| IUPAC name | ethyl (2S)-2-cyclopentyl-2-hydroxy-2-phenylacetate |
| InChIKey | YXQLGYVHODRFHA-OAHLLOKOSA-N |
| SMILES | CCOC(=O)[C@](C1CCCC1)(C2=CC=CC=C2)O |
Computed by PubChem (NCBI)