CAS 1332599-61-7 appears in our catalog under these names: Glycopyrrolate Impurity 27, Ethyl (alphaR)-alpha-Cyclopentyl-alpha-hydroxybenzeneacetate. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 100mg.
Ethyl (2R)-2-cyclopentyl-2-hydroxy-2-phenylacetate (CAS 1332599-61-7) is a chemical compound with the molecular formula C15H20O3 and a molecular weight of 248.32 g/mol. IUPAC name: ethyl (2R)-2-cyclopentyl-2-hydroxy-2-phenylacetate. InChIKey: YXQLGYVHODRFHA-HNNXBMFYSA-N.
| Molecular formula | C15H20O3 |
|---|---|
| Molecular weight | 248.32 g/mol |
| IUPAC name | ethyl (2R)-2-cyclopentyl-2-hydroxy-2-phenylacetate |
| InChIKey | YXQLGYVHODRFHA-HNNXBMFYSA-N |
| SMILES | CCOC(=O)[C@@](C1CCCC1)(C2=CC=CC=C2)O |
Computed by PubChem (NCBI)