Products 1253405-06-9
CAS 1253405-06-9 is the registry number for Az-mtab >= 98 % HPLC. Offered by: Sigma-Aldrich. Available pack sizes: 25MG.
3-[[(1R,5S)-8-[(5-methylthiophen-2-yl)methyl]-8-azabicyclo[3.2.1]octan-3-yl]oxy]benzamide (CAS 1253405-06-9) is a chemical compound with the molecular formula C20H24N2O2S and a molecular weight of 356.5 g/mol. IUPAC name: 3-[[(1R,5S)-8-[(5-methylthiophen-2-yl)methyl]-8-azabicyclo[3.2.1]octan-3-yl]oxy]benzamide. InChIKey: RLHOWHVHHMGIKE-BYICEURKSA-N.
| Molecular formula | C20H24N2O2S |
|---|---|
| Molecular weight | 356.5 g/mol |
| IUPAC name | 3-[[(1R,5S)-8-[(5-methylthiophen-2-yl)methyl]-8-azabicyclo[3.2.1]octan-3-yl]oxy]benzamide |
| InChIKey | RLHOWHVHHMGIKE-BYICEURKSA-N |
| SMILES | CC1=CC=C(S1)CN2[C@@H]3CC[C@H]2CC(C3)OC4=CC=CC(=C4)C(=O)N |
Computed by PubChem (NCBI)