CAS 2306261-91-4 is the registry number for 1'-Tosylspiro[cyclohexane-1,3'-indolin]-5'-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-(4-methylphenyl)sulfonylspiro[2H-indole-3,1'-cyclohexane]-5-amine (CAS 2306261-91-4) is a chemical compound with the molecular formula C20H24N2O2S and a molecular weight of 356.5 g/mol. IUPAC name: 1-(4-methylphenyl)sulfonylspiro[2H-indole-3,1'-cyclohexane]-5-amine. InChIKey: JUQFLTQQNOCMJD-UHFFFAOYSA-N.
| Molecular formula | C20H24N2O2S |
|---|---|
| Molecular weight | 356.5 g/mol |
| IUPAC name | 1-(4-methylphenyl)sulfonylspiro[2H-indole-3,1'-cyclohexane]-5-amine |
| InChIKey | JUQFLTQQNOCMJD-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)N2CC3(CCCCC3)C4=C2C=CC(=C4)N |
Computed by PubChem (NCBI)