Products 2270907-15-6

CAS 2270907-15-6 is the registry number for 4-(4-Amino-phenylsulfanylmethyl)-piperidine-1-carboxylic acid benzyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

Benzyl 4-[(4-aminophenyl)sulfanylmethyl]piperidine-1-carboxylate (CAS 2270907-15-6) is a chemical compound with the molecular formula C20H24N2O2S and a molecular weight of 356.5 g/mol. IUPAC name: benzyl 4-[(4-aminophenyl)sulfanylmethyl]piperidine-1-carboxylate. InChIKey: CMKIFUYJPXFZIN-UHFFFAOYSA-N.

Identity
Molecular formulaC20H24N2O2S
Molecular weight356.5 g/mol
IUPAC namebenzyl 4-[(4-aminophenyl)sulfanylmethyl]piperidine-1-carboxylate
InChIKeyCMKIFUYJPXFZIN-UHFFFAOYSA-N
SMILESC1CN(CCC1CSC2=CC=C(C=C2)N)C(=O)OCC3=CC=CC=C3

Computed by PubChem (NCBI)