CAS 125349-37-3 is the registry number for (R)-1,1,3-Trimethyl-2,3-dihydro-1H-inden-4-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(3R)-1,1,3-trimethyl-2,3-dihydroinden-4-amine (CAS 125349-37-3) is a chemical compound with the molecular formula C12H17N and a molecular weight of 175.27 g/mol. IUPAC name: (3R)-1,1,3-trimethyl-2,3-dihydroinden-4-amine. InChIKey: KYWYAWFSWFSPAY-MRVPVSSYSA-N.
| Molecular formula | C12H17N |
|---|---|
| Molecular weight | 175.27 g/mol |
| IUPAC name | (3R)-1,1,3-trimethyl-2,3-dihydroinden-4-amine |
| InChIKey | KYWYAWFSWFSPAY-MRVPVSSYSA-N |
| SMILES | C[C@@H]1CC(C2=C1C(=CC=C2)N)(C)C |
Computed by PubChem (NCBI)