CAS 94568-76-0 appears in our catalog under these names: 1,1,3-Trimethyl-2,3-dihydro-1h-inden-4-amine, 95%, 4-Amino-1,1,3-trimethylindane, 1,1,3-Trimethyl-2,3-dihydro-1H-inden-4-amine, 95%, 95%. Offered by: Combi-blocks, TRC, Biosynth, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg, 500mg.
1,1,3-trimethyl-2,3-dihydroinden-4-amine (CAS 94568-76-0) is a chemical compound with the molecular formula C12H17N and a molecular weight of 175.27 g/mol. IUPAC name: 1,1,3-trimethyl-2,3-dihydroinden-4-amine. InChIKey: KYWYAWFSWFSPAY-UHFFFAOYSA-N.
| Molecular formula | C12H17N |
|---|---|
| Molecular weight | 175.27 g/mol |
| IUPAC name | 1,1,3-trimethyl-2,3-dihydroinden-4-amine |
| InChIKey | KYWYAWFSWFSPAY-UHFFFAOYSA-N |
| SMILES | CC1CC(C2=C1C(=CC=C2)N)(C)C |
Computed by PubChem (NCBI)