CAS 1253641-15-4 is the registry number for Glycybenzofuran. Offered by: MedChemExpress. Available pack sizes: Get quote.
4-(6-hydroxy-3-methyl-1-benzofuran-2-yl)-5-methoxy-6-(3-methylbut-2-enyl)benzene-1,3-diol (CAS 1253641-15-4) is a chemical compound with the molecular formula C21H22O5 and a molecular weight of 354.4 g/mol. IUPAC name: 4-(6-hydroxy-3-methyl-1-benzofuran-2-yl)-5-methoxy-6-(3-methylbut-2-enyl)benzene-1,3-diol. InChIKey: OEIIVGQLDAYZNT-UHFFFAOYSA-N.
| Molecular formula | C21H22O5 |
|---|---|
| Molecular weight | 354.4 g/mol |
| IUPAC name | 4-(6-hydroxy-3-methyl-1-benzofuran-2-yl)-5-methoxy-6-(3-methylbut-2-enyl)benzene-1,3-diol |
| InChIKey | OEIIVGQLDAYZNT-UHFFFAOYSA-N |
| SMILES | CC1=C(OC2=C1C=CC(=C2)O)C3=C(C=C(C(=C3OC)CC=C(C)C)O)O |
Computed by PubChem (NCBI)