CAS 125377-87-9 appears in our catalog under these names: (S)-3-Amino-4-(trimethylammonio)butanoate, 97%, (S)-Amino Carnitine. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 1mg, 2,5mg, 5mg.
(3S)-3-amino-4-(trimethylazaniumyl)butanoate (CAS 125377-87-9) is a chemical compound with the molecular formula C7H16N2O2 and a molecular weight of 160.21 g/mol. IUPAC name: (3S)-3-amino-4-(trimethylazaniumyl)butanoate. InChIKey: DAWBGYHPBBDHMQ-LURJTMIESA-N.
| Molecular formula | C7H16N2O2 |
|---|---|
| Molecular weight | 160.21 g/mol |
| IUPAC name | (3S)-3-amino-4-(trimethylazaniumyl)butanoate |
| InChIKey | DAWBGYHPBBDHMQ-LURJTMIESA-N |
| SMILES | C[N+](C)(C)C[C@H](CC(=O)[O-])N |
Computed by PubChem (NCBI)