CAS 90430-75-4 is the registry number for 3-Amino-4-(trimethylazaniumyl)butanoate. Offered by: TRC. Available pack sizes: 750mg.
3-amino-4-(trimethylazaniumyl)butanoate (CAS 90430-75-4) is a chemical compound with the molecular formula C7H16N2O2 and a molecular weight of 160.21 g/mol. IUPAC name: 3-amino-4-(trimethylazaniumyl)butanoate. InChIKey: DAWBGYHPBBDHMQ-UHFFFAOYSA-N.
| Molecular formula | C7H16N2O2 |
|---|---|
| Molecular weight | 160.21 g/mol |
| IUPAC name | 3-amino-4-(trimethylazaniumyl)butanoate |
| InChIKey | DAWBGYHPBBDHMQ-UHFFFAOYSA-N |
| SMILES | C[N+](C)(C)CC(CC(=O)[O-])N |
Computed by PubChem (NCBI)