CAS 1253792-35-6 appears in our catalog under these names: 6–(Benzyloxy)–4–fluoro–1H–indazole, 6-(Benzyloxy)-4-fluoro-1h-indazole, 95%, 6-(Benzyloxy)-4-fluoro-1H-indazole, 95%, 95%. Offered by: GLPBio, Combi-blocks, Fluorochem, Ambeed, Chemat. Available pack sizes: 100mg, 1g, 250mg.
4-fluoro-6-phenylmethoxy-1H-indazole (CAS 1253792-35-6) is a chemical compound with the molecular formula C14H11FN2O and a molecular weight of 242.25 g/mol. IUPAC name: 4-fluoro-6-phenylmethoxy-1H-indazole. InChIKey: ZMTWJVOKLKCQGT-UHFFFAOYSA-N.
| Molecular formula | C14H11FN2O |
|---|---|
| Molecular weight | 242.25 g/mol |
| IUPAC name | 4-fluoro-6-phenylmethoxy-1H-indazole |
| InChIKey | ZMTWJVOKLKCQGT-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=CC3=C(C=NN3)C(=C2)F |
Computed by PubChem (NCBI)