Products 1809015-77-7
CAS 1809015-77-7 is the registry number for Berotralstat Related Compound 3. Offered by: Chemat Brand. Available pack sizes: on request.
3-[(3-amino-4-fluorophenyl)-hydroxymethyl]benzonitrile (CAS 1809015-77-7) is a chemical compound with the molecular formula C14H11FN2O and a molecular weight of 242.25 g/mol. IUPAC name: 3-[(3-amino-4-fluorophenyl)-hydroxymethyl]benzonitrile. InChIKey: CANRWVKEQREKLZ-UHFFFAOYSA-N.
| Molecular formula | C14H11FN2O |
|---|---|
| Molecular weight | 242.25 g/mol |
| IUPAC name | 3-[(3-amino-4-fluorophenyl)-hydroxymethyl]benzonitrile |
| InChIKey | CANRWVKEQREKLZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C(C2=CC(=C(C=C2)F)N)O)C#N |
Computed by PubChem (NCBI)