CAS 1254038-52-2 is the registry number for 1-(2-Bromo-1,1-difluoroethyl)-4-(trifluoromethyl)-benzene, 98%. Offered by: Fluorochem. Available pack sizes: 1g.
1-(2-bromo-1,1-difluoroethyl)-4-(trifluoromethyl)benzene (CAS 1254038-52-2) is a chemical compound with the molecular formula C9H6BrF5 and a molecular weight of 289.04 g/mol. IUPAC name: 1-(2-bromo-1,1-difluoroethyl)-4-(trifluoromethyl)benzene. InChIKey: ZAEQXWHHJYBETJ-UHFFFAOYSA-N.
| Molecular formula | C9H6BrF5 |
|---|---|
| Molecular weight | 289.04 g/mol |
| IUPAC name | 1-(2-bromo-1,1-difluoroethyl)-4-(trifluoromethyl)benzene |
| InChIKey | ZAEQXWHHJYBETJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(CBr)(F)F)C(F)(F)F |
Computed by PubChem (NCBI)