CAS 1629281-47-5 is the registry number for 1-Bromo-3-(1,1-difluoroethyl)-5-(trifluoromethyl)benzene, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-bromo-3-(1,1-difluoroethyl)-5-(trifluoromethyl)benzene (CAS 1629281-47-5) is a chemical compound with the molecular formula C9H6BrF5 and a molecular weight of 289.04 g/mol. IUPAC name: 1-bromo-3-(1,1-difluoroethyl)-5-(trifluoromethyl)benzene. InChIKey: SAYJTXXUQLTXFX-UHFFFAOYSA-N.
| Molecular formula | C9H6BrF5 |
|---|---|
| Molecular weight | 289.04 g/mol |
| IUPAC name | 1-bromo-3-(1,1-difluoroethyl)-5-(trifluoromethyl)benzene |
| InChIKey | SAYJTXXUQLTXFX-UHFFFAOYSA-N |
| SMILES | CC(C1=CC(=CC(=C1)Br)C(F)(F)F)(F)F |
Computed by PubChem (NCBI)