CAS 1254038-57-7 is the registry number for 1-(2-Azido-1,1-difluoroethyl)-4-chlorobenzene. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
1-(2-azido-1,1-difluoroethyl)-4-chlorobenzene (CAS 1254038-57-7) is a chemical compound with the molecular formula C8H6ClF2N3 and a molecular weight of 217.60 g/mol. IUPAC name: 1-(2-azido-1,1-difluoroethyl)-4-chlorobenzene. InChIKey: WVCBIXSJPLZJBM-UHFFFAOYSA-N.
| Molecular formula | C8H6ClF2N3 |
|---|---|
| Molecular weight | 217.60 g/mol |
| IUPAC name | 1-(2-azido-1,1-difluoroethyl)-4-chlorobenzene |
| InChIKey | WVCBIXSJPLZJBM-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(CN=[N+]=[N-])(F)F)Cl |
Computed by PubChem (NCBI)