CAS 2756656-91-2 is the registry number for 4-Chloro-3-(1,1-difluoroethyl)-1H-pyrazolo[4,3-c]pyridine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
4-chloro-3-(1,1-difluoroethyl)-2H-pyrazolo[4,3-c]pyridine (CAS 2756656-91-2) is a chemical compound with the molecular formula C8H6ClF2N3 and a molecular weight of 217.60 g/mol. IUPAC name: 4-chloro-3-(1,1-difluoroethyl)-2H-pyrazolo[4,3-c]pyridine. InChIKey: NRGKXRSKGVTQLH-UHFFFAOYSA-N.
| Molecular formula | C8H6ClF2N3 |
|---|---|
| Molecular weight | 217.60 g/mol |
| IUPAC name | 4-chloro-3-(1,1-difluoroethyl)-2H-pyrazolo[4,3-c]pyridine |
| InChIKey | NRGKXRSKGVTQLH-UHFFFAOYSA-N |
| SMILES | CC(C1=C2C(=NN1)C=CN=C2Cl)(F)F |
Computed by PubChem (NCBI)