Products 125421-98-9
CAS 125421-98-9 is the registry number for 3-(Piperazin-1-yl)aniline hydrochloride, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g.
3-piperazin-1-ylaniline;hydrochloride (CAS 125421-98-9) is a chemical compound with the molecular formula C10H16ClN3 and a molecular weight of 213.71 g/mol. IUPAC name: 3-piperazin-1-ylaniline;hydrochloride. InChIKey: YOEUZWWMUIPIAC-UHFFFAOYSA-N.
| Molecular formula | C10H16ClN3 |
|---|---|
| Molecular weight | 213.71 g/mol |
| IUPAC name | 3-piperazin-1-ylaniline;hydrochloride |
| InChIKey | YOEUZWWMUIPIAC-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)C2=CC=CC(=C2)N.Cl |
Computed by PubChem (NCBI)