Products 125454-26-4

CAS 125454-26-4 is the registry number for Simazine-acetic acid. Offered by: MedChemExpress. Available pack sizes: Get quote.

Structural formula: {0} (CAS {1})

4-[[4-chloro-6-(ethylamino)-1,3,5-triazin-2-yl]amino]butanoic acid (CAS 125454-26-4) is a chemical compound with the molecular formula C9H14ClN5O2 and a molecular weight of 259.69 g/mol. IUPAC name: 4-[[4-chloro-6-(ethylamino)-1,3,5-triazin-2-yl]amino]butanoic acid. InChIKey: QJCNXQQKVJBFEF-UHFFFAOYSA-N.

Identity
Molecular formulaC9H14ClN5O2
Molecular weight259.69 g/mol
IUPAC name4-[[4-chloro-6-(ethylamino)-1,3,5-triazin-2-yl]amino]butanoic acid
InChIKeyQJCNXQQKVJBFEF-UHFFFAOYSA-N
SMILESCCNC1=NC(=NC(=N1)Cl)NCCCC(=O)O

Computed by PubChem (NCBI)