CAS 36576-43-9 appears in our catalog under these names: Cyanazine Acid, >95% (HPLC), Cyanazine acid. Offered by: TRC, HPC Standards. Available pack sizes: 100mg, 25mg, 50mg, 1x10mg.
2-[[4-chloro-6-(ethylamino)-1,3,5-triazin-2-yl]amino]-2-methylpropanoic acid (CAS 36576-43-9) is a chemical compound with the molecular formula C9H14ClN5O2 and a molecular weight of 259.69 g/mol. IUPAC name: 2-[[4-chloro-6-(ethylamino)-1,3,5-triazin-2-yl]amino]-2-methylpropanoic acid. InChIKey: WYIJTMNAAMADHT-UHFFFAOYSA-N.
| Molecular formula | C9H14ClN5O2 |
|---|---|
| Molecular weight | 259.69 g/mol |
| IUPAC name | 2-[[4-chloro-6-(ethylamino)-1,3,5-triazin-2-yl]amino]-2-methylpropanoic acid |
| InChIKey | WYIJTMNAAMADHT-UHFFFAOYSA-N |
| SMILES | CCNC1=NC(=NC(=N1)Cl)NC(C)(C)C(=O)O |
Computed by PubChem (NCBI)