CAS 1254693-88-3 is the registry number for (S)-Naproxen-d6 methyl ester. Offered by: Biosynth. Available pack sizes: 50mg, 25mg, 100mg.
Trideuteriomethyl (2S)-2-[6-(trideuteriomethoxy)naphthalen-2-yl]propanoate (CAS 1254693-88-3) is a chemical compound with the molecular formula C15H16O3 and a molecular weight of 250.32 g/mol. IUPAC name: trideuteriomethyl (2S)-2-[6-(trideuteriomethoxy)naphthalen-2-yl]propanoate. InChIKey: ZFYFBPCRUQZGJE-LJTFXESQSA-N.
| Molecular formula | C15H16O3 |
|---|---|
| Molecular weight | 250.32 g/mol |
| IUPAC name | trideuteriomethyl (2S)-2-[6-(trideuteriomethoxy)naphthalen-2-yl]propanoate |
| InChIKey | ZFYFBPCRUQZGJE-LJTFXESQSA-N |
| SMILES | [2H]C([2H])([2H])OC1=CC2=C(C=C1)C=C(C=C2)[C@H](C)C(=O)OC([2H])([2H])[2H] |
Computed by PubChem (NCBI)