CAS 125488-14-4 appears in our catalog under these names: 2,4-Dichlorophenacyl thiocyanate, 95%, 1-(2,4-Dichlorophenyl)-2-thiocyanatoethanone, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 5g.
[2-(2,4-dichlorophenyl)-2-oxoethyl] thiocyanate (CAS 125488-14-4) is a chemical compound with the molecular formula C9H5Cl2NOS and a molecular weight of 246.11 g/mol. IUPAC name: [2-(2,4-dichlorophenyl)-2-oxoethyl] thiocyanate. InChIKey: XYNNFKLKIQXPHS-UHFFFAOYSA-N.
| Molecular formula | C9H5Cl2NOS |
|---|---|
| Molecular weight | 246.11 g/mol |
| IUPAC name | [2-(2,4-dichlorophenyl)-2-oxoethyl] thiocyanate |
| InChIKey | XYNNFKLKIQXPHS-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)Cl)C(=O)CSC#N |
Computed by PubChem (NCBI)