CAS 34586-85-1 appears in our catalog under these names: 3,6-Dichloro-1-benzothiophene-2-carboxamide, 3,6-Dichloro-1-benzothiophene-2-carboxamide, 95%. Offered by: Biosynth, AmBeed. Available pack sizes: 0,5g, 50mg, 5g.
3,6-dichloro-1-benzothiophene-2-carboxamide (CAS 34586-85-1) is a chemical compound with the molecular formula C9H5Cl2NOS and a molecular weight of 246.11 g/mol. IUPAC name: 3,6-dichloro-1-benzothiophene-2-carboxamide. InChIKey: XAZABYGIZOUFKN-UHFFFAOYSA-N.
| Molecular formula | C9H5Cl2NOS |
|---|---|
| Molecular weight | 246.11 g/mol |
| IUPAC name | 3,6-dichloro-1-benzothiophene-2-carboxamide |
| InChIKey | XAZABYGIZOUFKN-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Cl)SC(=C2Cl)C(=O)N |
Computed by PubChem (NCBI)