CAS 1254951-93-3 is the registry number for 4,4'-Dibromo-5,5'-bithiazole, 95%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g.
4-bromo-5-(4-bromo-1,3-thiazol-5-yl)-1,3-thiazole (CAS 1254951-93-3) is a chemical compound with the molecular formula C6H2Br2N2S2 and a molecular weight of 326.0 g/mol. IUPAC name: 4-bromo-5-(4-bromo-1,3-thiazol-5-yl)-1,3-thiazole. InChIKey: XRLLAFRUWXQXKE-UHFFFAOYSA-N.
| Molecular formula | C6H2Br2N2S2 |
|---|---|
| Molecular weight | 326.0 g/mol |
| IUPAC name | 4-bromo-5-(4-bromo-1,3-thiazol-5-yl)-1,3-thiazole |
| InChIKey | XRLLAFRUWXQXKE-UHFFFAOYSA-N |
| SMILES | C1=NC(=C(S1)C2=C(N=CS2)Br)Br |
Computed by PubChem (NCBI)