CAS 960069-36-7 is the registry number for 2,2'-Dibromo-5,5'-bithiazole, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-bromo-5-(2-bromo-1,3-thiazol-5-yl)-1,3-thiazole (CAS 960069-36-7) is a chemical compound with the molecular formula C6H2Br2N2S2 and a molecular weight of 326.0 g/mol. IUPAC name: 2-bromo-5-(2-bromo-1,3-thiazol-5-yl)-1,3-thiazole. InChIKey: MTGXDGXSMKXRLQ-UHFFFAOYSA-N.
| Molecular formula | C6H2Br2N2S2 |
|---|---|
| Molecular weight | 326.0 g/mol |
| IUPAC name | 2-bromo-5-(2-bromo-1,3-thiazol-5-yl)-1,3-thiazole |
| InChIKey | MTGXDGXSMKXRLQ-UHFFFAOYSA-N |
| SMILES | C1=C(SC(=N1)Br)C2=CN=C(S2)Br |
Computed by PubChem (NCBI)