Products 1255098-67-9
CAS 1255098-67-9 appears in our catalog under these names: 4-Amino-3-trifluoromethyl-piperidine-1-carboxylic acid tert-butyl ester, 95%, tert-Butyl 4-amino-3-(trifluoromethyl)piperidine-1-carboxylate, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 10g, 5g.
Tert-butyl 4-amino-3-(trifluoromethyl)piperidine-1-carboxylate (CAS 1255098-67-9) is a chemical compound with the molecular formula C11H19F3N2O2 and a molecular weight of 268.28 g/mol. IUPAC name: tert-butyl 4-amino-3-(trifluoromethyl)piperidine-1-carboxylate. InChIKey: LGIQYBKJHLHGST-UHFFFAOYSA-N.
| Molecular formula | C11H19F3N2O2 |
|---|---|
| Molecular weight | 268.28 g/mol |
| IUPAC name | tert-butyl 4-amino-3-(trifluoromethyl)piperidine-1-carboxylate |
| InChIKey | LGIQYBKJHLHGST-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(C(C1)C(F)(F)F)N |
Computed by PubChem (NCBI)