Products 1408075-51-3
CAS 1408075-51-3 is the registry number for 1-Boc-3-amino-3-trifluoromethylpiperidine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
Tert-butyl 3-amino-3-(trifluoromethyl)piperidine-1-carboxylate (CAS 1408075-51-3) is a chemical compound with the molecular formula C11H19F3N2O2 and a molecular weight of 268.28 g/mol. IUPAC name: tert-butyl 3-amino-3-(trifluoromethyl)piperidine-1-carboxylate. InChIKey: JNEXPUFWSRUNAR-UHFFFAOYSA-N.
| Molecular formula | C11H19F3N2O2 |
|---|---|
| Molecular weight | 268.28 g/mol |
| IUPAC name | tert-butyl 3-amino-3-(trifluoromethyl)piperidine-1-carboxylate |
| InChIKey | JNEXPUFWSRUNAR-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCCC(C1)(C(F)(F)F)N |
Computed by PubChem (NCBI)