CAS 1255098-81-7 appears in our catalog under these names: Ethyl cis-2-methylpiperidine-3-carboxylate hydrochloride, 95%, cis-Ethyl 2-methylpiperidine-3-carboxylate hydrochloride, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g.
Ethyl (2R,3R)-2-methylpiperidine-3-carboxylate;hydrochloride (CAS 1255098-81-7) is a chemical compound with the molecular formula C9H18ClNO2 and a molecular weight of 207.70 g/mol. IUPAC name: ethyl (2R,3R)-2-methylpiperidine-3-carboxylate;hydrochloride. InChIKey: KMXDWCJZWWWMEY-SCLLHFNJSA-N.
| Molecular formula | C9H18ClNO2 |
|---|---|
| Molecular weight | 207.70 g/mol |
| IUPAC name | ethyl (2R,3R)-2-methylpiperidine-3-carboxylate;hydrochloride |
| InChIKey | KMXDWCJZWWWMEY-SCLLHFNJSA-N |
| SMILES | CCOC(=O)[C@@H]1CCCN[C@@H]1C.Cl |
Computed by PubChem (NCBI)