CAS 1255147-33-1 is the registry number for 2-(Aminomethyl)-6-chloro-n-cyclopentylquinazolin-4-amine, 95%. Offered by: Combi-blocks. Available pack sizes: 500mg.
2-(aminomethyl)-6-chloro-N-cyclopentylquinazolin-4-amine (CAS 1255147-33-1) is a chemical compound with the molecular formula C14H17ClN4 and a molecular weight of 276.76 g/mol. IUPAC name: 2-(aminomethyl)-6-chloro-N-cyclopentylquinazolin-4-amine. InChIKey: RJSFJKDMOYOCLK-UHFFFAOYSA-N.
| Molecular formula | C14H17ClN4 |
|---|---|
| Molecular weight | 276.76 g/mol |
| IUPAC name | 2-(aminomethyl)-6-chloro-N-cyclopentylquinazolin-4-amine |
| InChIKey | RJSFJKDMOYOCLK-UHFFFAOYSA-N |
| SMILES | C1CCC(C1)NC2=NC(=NC3=C2C=C(C=C3)Cl)CN |
Computed by PubChem (NCBI)