CAS 99011-78-6 appears in our catalog under these names: Imiquimod hydrochloride/ 99.18% (existing batch purity), Imiquimod hydrochloride, Imiquimod hydrochloride, Imiquimod HCl 99%, Imiquimod hydrochloride, 99%, 99%. Offered by: TargetMol, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 50mg, 100mg, 250mg, 500mg, 1000mg, 1g, 5g, 500 mg.
1-(2-methylpropyl)imidazo[4,5-c]quinolin-4-amine;hydrochloride (CAS 99011-78-6) is a chemical compound with the molecular formula C14H17ClN4 and a molecular weight of 276.76 g/mol. IUPAC name: 1-(2-methylpropyl)imidazo[4,5-c]quinolin-4-amine;hydrochloride. InChIKey: RGKLRAHQVIHCCH-UHFFFAOYSA-N.
| Molecular formula | C14H17ClN4 |
|---|---|
| Molecular weight | 276.76 g/mol |
| IUPAC name | 1-(2-methylpropyl)imidazo[4,5-c]quinolin-4-amine;hydrochloride |
| InChIKey | RGKLRAHQVIHCCH-UHFFFAOYSA-N |
| SMILES | CC(C)CN1C=NC2=C1C3=CC=CC=C3N=C2N.Cl |
Computed by PubChem (NCBI)