Products 1255147-40-0

CAS 1255147-40-0 is the registry number for 2-(3-Cyanophenoxy)quinoline-4-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

2-(3-cyanophenoxy)quinoline-4-carboxylic acid (CAS 1255147-40-0) is a chemical compound with the molecular formula C17H10N2O3 and a molecular weight of 290.27 g/mol. IUPAC name: 2-(3-cyanophenoxy)quinoline-4-carboxylic acid. InChIKey: OUVKVNDBPGXOIM-UHFFFAOYSA-N.

Identity
Molecular formulaC17H10N2O3
Molecular weight290.27 g/mol
IUPAC name2-(3-cyanophenoxy)quinoline-4-carboxylic acid
InChIKeyOUVKVNDBPGXOIM-UHFFFAOYSA-N
SMILESC1=CC=C2C(=C1)C(=CC(=N2)OC3=CC=CC(=C3)C#N)C(=O)O

Computed by PubChem (NCBI)