CAS 16707-41-8 appears in our catalog under these names: N-[4-(2-Benzoxazolyl)phenyl]maleimide, 95%, 1-(4-(Benzo[d]oxazol-2-yl)phenyl)-1H-pyrrole-2,5-dione, 95%, 95%, 1-(4-(Benzo[d]oxazol-2-yl)phenyl)-1H-pyrrole-2,5-dione, 98%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g.
1-[4-(1,3-benzoxazol-2-yl)phenyl]pyrrole-2,5-dione (CAS 16707-41-8) is a chemical compound with the molecular formula C17H10N2O3 and a molecular weight of 290.27 g/mol. IUPAC name: 1-[4-(1,3-benzoxazol-2-yl)phenyl]pyrrole-2,5-dione. InChIKey: BGGCPIFVRJFAKF-UHFFFAOYSA-N.
| Molecular formula | C17H10N2O3 |
|---|---|
| Molecular weight | 290.27 g/mol |
| IUPAC name | 1-[4-(1,3-benzoxazol-2-yl)phenyl]pyrrole-2,5-dione |
| InChIKey | BGGCPIFVRJFAKF-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)N=C(O2)C3=CC=C(C=C3)N4C(=O)C=CC4=O |
Computed by PubChem (NCBI)