CAS 1255147-60-4 appears in our catalog under these names: 2-Bromo-1-(1,2,5-trimethyl-1h-indol-3-yl)propan-1-one, 95%, 2-Bromo-1-(1,2,5-trimethyl-1H-indol-3-yl)propan-1-one. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 1g, 500mg, 1000mg, 2000mg.
2-bromo-1-(1,2,5-trimethylindol-3-yl)propan-1-one (CAS 1255147-60-4) is a chemical compound with the molecular formula C14H16BrNO and a molecular weight of 294.19 g/mol. IUPAC name: 2-bromo-1-(1,2,5-trimethylindol-3-yl)propan-1-one. InChIKey: GINRVUQOFVPGKU-UHFFFAOYSA-N.
| Molecular formula | C14H16BrNO |
|---|---|
| Molecular weight | 294.19 g/mol |
| IUPAC name | 2-bromo-1-(1,2,5-trimethylindol-3-yl)propan-1-one |
| InChIKey | GINRVUQOFVPGKU-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1)N(C(=C2C(=O)C(C)Br)C)C |
Computed by PubChem (NCBI)