CAS 2789682-48-8 is the registry number for 6'-Bromo-2'-methyl-2',3'-dihydro-1'H-spiro[cyclopentane-1,4'-isoquinolin]-1'-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
6-bromo-2-methylspiro[3H-isoquinoline-4,1'-cyclopentane]-1-one (CAS 2789682-48-8) is a chemical compound with the molecular formula C14H16BrNO and a molecular weight of 294.19 g/mol. IUPAC name: 6-bromo-2-methylspiro[3H-isoquinoline-4,1'-cyclopentane]-1-one. InChIKey: ZFRJOZWEZTWKPX-UHFFFAOYSA-N.
| Molecular formula | C14H16BrNO |
|---|---|
| Molecular weight | 294.19 g/mol |
| IUPAC name | 6-bromo-2-methylspiro[3H-isoquinoline-4,1'-cyclopentane]-1-one |
| InChIKey | ZFRJOZWEZTWKPX-UHFFFAOYSA-N |
| SMILES | CN1CC2(CCCC2)C3=C(C1=O)C=CC(=C3)Br |
Computed by PubChem (NCBI)