CAS 1255147-61-5 is the registry number for 10-Fluoro-2-methylpyrimido[1,2-b]indazol-4-ol, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
10-fluoro-2-methyl-6H-pyrimido[1,2-b]indazol-4-one (CAS 1255147-61-5) is a chemical compound with the molecular formula C11H8FN3O and a molecular weight of 217.20 g/mol. IUPAC name: 10-fluoro-2-methyl-6H-pyrimido[1,2-b]indazol-4-one. InChIKey: RXFVNCHLBUAJEJ-UHFFFAOYSA-N.
| Molecular formula | C11H8FN3O |
|---|---|
| Molecular weight | 217.20 g/mol |
| IUPAC name | 10-fluoro-2-methyl-6H-pyrimido[1,2-b]indazol-4-one |
| InChIKey | RXFVNCHLBUAJEJ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=O)N2C(=N1)C3=C(N2)C=CC=C3F |
Computed by PubChem (NCBI)