Products 1429342-56-2
CAS 1429342-56-2 is the registry number for N-(3-Fluoropyridin-4-yl)isonicotinamide, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
N-(3-fluoro-4-pyridinyl)pyridine-4-carboxamide (CAS 1429342-56-2) is a chemical compound with the molecular formula C11H8FN3O and a molecular weight of 217.20 g/mol. IUPAC name: N-(3-fluoro-4-pyridinyl)pyridine-4-carboxamide. InChIKey: GCWHJRKOFLTLNM-UHFFFAOYSA-N.
| Molecular formula | C11H8FN3O |
|---|---|
| Molecular weight | 217.20 g/mol |
| IUPAC name | N-(3-fluoro-4-pyridinyl)pyridine-4-carboxamide |
| InChIKey | GCWHJRKOFLTLNM-UHFFFAOYSA-N |
| SMILES | C1=CN=CC=C1C(=O)NC2=C(C=NC=C2)F |
Computed by PubChem (NCBI)